C19H14F3N7O2S — CID 55443657
6-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 55443657) has the molecular formula C19H14F3N7O2S and a molecular weight of 461.43 g/mol. Its IUPAC name is 6-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 55443657 |
| Molecular Formula | C19H14F3N7O2S |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 6-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CSc2nnc(-c3ccc(OC(F)F)cc3)o2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H14F3N7O2S/c20-11-3-5-12(6-4-11)24-18-26-14(25-17(23)27-18)9-32-19-29-28-15(31-19)10-1-7-13(8-2-10)30-16(21)22/h1-8,16H,9H2,(H3,23,24,25,26,27) |
| InChIKey | MKEXMZMHOMHUTC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |