C18H17IN2O5 — CID 55443919
[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55443919) has the molecular formula C18H17IN2O5 and a molecular weight of 468.25 g/mol. Its IUPAC name is [2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55443919 |
| Molecular Formula | C18H17IN2O5 |
| Molecular Weight | 468.25 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | [2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(I)o1)OCC(=O)c1c[nH]c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H17IN2O5/c19-16-5-3-13(26-16)4-6-17(23)25-11-15(22)12-9-14(20-10-12)18(24)21-7-1-2-8-21/h3-6,9-10,20H,1-2,7-8,11H2/b6-4+ |
| InChIKey | MOSFJCARCJKZCC-GQCTYLIASA-N |
| XLogP | 2.89 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|