About (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate
(2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 55444411) has the molecular formula C19H18F3NO4S
and a molecular weight of 413.42 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate.
Molecular Properties
| Compound Name | (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
| PubChem CID | 55444411 |
| Molecular Formula | C19H18F3NO4S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C(OCc1cccc(F)c1F)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H18F3NO4S/c20-15-6-8-16(9-7-15)28(25,26)23-10-2-4-13(11-23)19(24)27-12-14-3-1-5-17(21)18(14)22/h1,3,5-9,13H,2,4,10-12H2 |
| InChIKey | DHQDLOODJFBBMM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate?
The IUPAC name of (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate (CID 55444411) is (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate.
What is the SMILES notation for (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate?
The canonical SMILES for (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate is O=C(OCc1cccc(F)c1F)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1.
What is the InChIKey of (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate?
The InChIKey is DHQDLOODJFBBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F3NO4S/c20-15-6-8-16(9-7-15)28(25,26)23-10-2-4-13(11-23)19(24)27-12-14-3-1-5-17(21)18(14)22/h1,3,5-9,13H,2,4,10-12H2.
What are the key properties of (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate?
(2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate has a molecular weight of 413.42 g/mol, XLogP of 3.25, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate is sourced from PubChem (CID 55444411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).