About (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate
(2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate (PubChem CID 55444463) has the molecular formula C18H22F2N2O2
and a molecular weight of 336.38 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate.
Molecular Properties
| Compound Name | (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
| PubChem CID | 55444463 |
| Molecular Formula | C18H22F2N2O2 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)OCc1cccc(F)c1F |
| InChI | InChI=1S/C18H22F2N2O2/c1-11(2)9-22-13(4)15(12(3)21-22)8-17(23)24-10-14-6-5-7-16(19)18(14)20/h5-7,11H,8-10H2,1-4H3 |
| InChIKey | YBSYFZHNKWLALT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The IUPAC name of (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate (CID 55444463) is (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate.
What is the SMILES notation for (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The canonical SMILES for (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate is Cc1nn(CC(C)C)c(C)c1CC(=O)OCc1cccc(F)c1F.
What is the InChIKey of (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The InChIKey is YBSYFZHNKWLALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2N2O2/c1-11(2)9-22-13(4)15(12(3)21-22)8-17(23)24-10-14-6-5-7-16(19)18(14)20/h5-7,11H,8-10H2,1-4H3.
What are the key properties of (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
(2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate has a molecular weight of 336.38 g/mol, XLogP of 3.72, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluorophenyl)methyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate is sourced from PubChem (CID 55444463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).