C23H20ClN3O2 — CID 55446419
N-benzyl-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methoxyaniline (PubChem CID 55446419) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N-benzyl-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methoxyaniline.
| Compound Name | N-benzyl-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 55446419 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-benzyl-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-methoxyaniline |
| SMILES | COc1ccc(N(Cc2ccccc2)Cc2nnc(-c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C23H20ClN3O2/c1-28-21-13-11-20(12-14-21)27(15-17-5-3-2-4-6-17)16-22-25-26-23(29-22)18-7-9-19(24)10-8-18/h2-14H,15-16H2,1H3 |
| InChIKey | HMEDIJMRAZCNCS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|