C16H20F3NO — CID 55447256
2-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 55447256) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is 2-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55447256 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-cyclohexyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CC1CCCCC1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO/c17-16(18,19)14-8-6-13(7-9-14)11-20-15(21)10-12-4-2-1-3-5-12/h6-9,12H,1-5,10-11H2,(H,20,21) |
| InChIKey | VRPCUGXRODKGOD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |