About (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate
(4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate (PubChem CID 55447938) has the molecular formula C21H17N3O3
and a molecular weight of 359.38 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate.
Molecular Properties
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate |
| PubChem CID | 55447938 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate |
| SMILES | O=C(Cc1coc(-c2ccccc2)n1)OCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H17N3O3/c25-20(13-18-15-27-21(23-18)17-5-2-1-3-6-17)26-14-16-7-9-19(10-8-16)24-12-4-11-22-24/h1-12,15H,13-14H2 |
| InChIKey | WQZLHULJHMTZAV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate?
The IUPAC name of (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate (CID 55447938) is (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate.
What is the SMILES notation for (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate?
The canonical SMILES for (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate is O=C(Cc1coc(-c2ccccc2)n1)OCc1ccc(-n2cccn2)cc1.
What is the InChIKey of (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate?
The InChIKey is WQZLHULJHMTZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O3/c25-20(13-18-15-27-21(23-18)17-5-2-1-3-6-17)26-14-16-7-9-19(10-8-16)24-12-4-11-22-24/h1-12,15H,13-14H2.
What are the key properties of (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate?
(4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate has a molecular weight of 359.38 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pyrazol-1-ylphenyl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate is sourced from PubChem (CID 55447938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).