About [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate
[2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate (PubChem CID 55448128) has the molecular formula C19H25FN2O4
and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate.
Molecular Properties
| Compound Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate |
| PubChem CID | 55448128 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate |
| SMILES | NC(=O)CCN(C(=O)COC(=O)CC1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN2O4/c20-15-6-8-16(9-7-15)22(11-10-17(21)23)18(24)13-26-19(25)12-14-4-2-1-3-5-14/h6-9,14H,1-5,10-13H2,(H2,21,23) |
| InChIKey | USOJVBLINZPNIO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate?
The IUPAC name of [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate (CID 55448128) is [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate.
What is the SMILES notation for [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate?
The canonical SMILES for [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate is NC(=O)CCN(C(=O)COC(=O)CC1CCCCC1)c1ccc(F)cc1.
What is the InChIKey of [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate?
The InChIKey is USOJVBLINZPNIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25FN2O4/c20-15-6-8-16(9-7-15)22(11-10-17(21)23)18(24)13-26-19(25)12-14-4-2-1-3-5-14/h6-9,14H,1-5,10-13H2,(H2,21,23).
What are the key properties of [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate?
[2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate has a molecular weight of 364.42 g/mol, XLogP of 2.55, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 2-cyclohexylacetate is sourced from PubChem (CID 55448128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).