About [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate
[2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 55449045) has the molecular formula C20H27NO5S2
and a molecular weight of 425.57 g/mol. Its IUPAC name is [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate.
Molecular Properties
| Compound Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate |
| PubChem CID | 55449045 |
| Molecular Formula | C20H27NO5S2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)COC(=O)C2C3CC4CC(C3)CC2C4)s1 |
| InChI | InChI=1S/C20H27NO5S2/c1-28(24,25)21-5-4-16-2-3-18(27-16)17(22)11-26-20(23)19-14-7-12-6-13(9-14)10-15(19)8-12/h2-3,12-15,19,21H,4-11H2,1H3 |
| InChIKey | QFZRNPCICSNLSV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate?
The IUPAC name of [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate (CID 55449045) is [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate.
What is the SMILES notation for [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate?
The canonical SMILES for [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate is CS(=O)(=O)NCCc1ccc(C(=O)COC(=O)C2C3CC4CC(C3)CC2C4)s1.
What is the InChIKey of [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate?
The InChIKey is QFZRNPCICSNLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO5S2/c1-28(24,25)21-5-4-16-2-3-18(27-16)17(22)11-26-20(23)19-14-7-12-6-13(9-14)10-15(19)8-12/h2-3,12-15,19,21H,4-11H2,1H3.
What are the key properties of [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate?
[2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate has a molecular weight of 425.57 g/mol, XLogP of 2.64, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[5-[2-(methanesulfonamido)ethyl]thiophen-2-yl]-2-oxoethyl] adamantane-2-carboxylate is sourced from PubChem (CID 55449045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).