C23H23N3O5 — CID 55450290
[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxo-1-phenylethyl] 3-benzamidobutanoate (PubChem CID 55450290) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxo-1-phenylethyl] 3-benzamidobutanoate.
| Compound Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxo-1-phenylethyl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 55450290 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxo-1-phenylethyl] 3-benzamidobutanoate |
| SMILES | Cc1cc(NC(=O)C(OC(=O)CC(C)NC(=O)c2ccccc2)c2ccccc2)no1 |
| InChI | InChI=1S/C23H23N3O5/c1-15(24-22(28)18-11-7-4-8-12-18)13-20(27)30-21(17-9-5-3-6-10-17)23(29)25-19-14-16(2)31-26-19/h3-12,14-15,21H,13H2,1-2H3,(H,24,28)(H,25,26,29) |
| InChIKey | QAJIVVBYKJESPO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |