C24H34N4O5 — CID 55450468
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,4-dimethoxy-N-(2-methylpropyl)-5-prop-2-enylbenzamide (PubChem CID 55450468) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,4-dimethoxy-N-(2-methylpropyl)-5-prop-2-enylbenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,4-dimethoxy-N-(2-methylpropyl)-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55450468 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,4-dimethoxy-N-(2-methylpropyl)-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)N(CC(C)C)c2c(N)n(CCCC)c(=O)[nH]c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H34N4O5/c1-7-9-11-27-21(25)19(22(29)26-24(27)31)28(14-15(3)4)23(30)17-12-16(10-8-2)20(33-6)18(13-17)32-5/h8,12-13,15H,2,7,9-11,14,25H2,1,3-6H3,(H,26,29,31) |
| InChIKey | UJKBDLVZPDMMDF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|