C20H21ClFNO3S — CID 55450580
2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[3-(4-fluorophenyl)sulfanylpropyl]acetamide (PubChem CID 55450580) has the molecular formula C20H21ClFNO3S and a molecular weight of 409.91 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[3-(4-fluorophenyl)sulfanylpropyl]acetamide.
| Compound Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[3-(4-fluorophenyl)sulfanylpropyl]acetamide |
|---|---|
| PubChem CID | 55450580 |
| Molecular Formula | C20H21ClFNO3S |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[3-(4-fluorophenyl)sulfanylpropyl]acetamide |
| SMILES | O=C(Cc1cc(Cl)c2c(c1)OCCCO2)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21ClFNO3S/c21-17-11-14(12-18-20(17)26-9-2-8-25-18)13-19(24)23-7-1-10-27-16-5-3-15(22)4-6-16/h3-6,11-12H,1-2,7-10,13H2,(H,23,24) |
| InChIKey | LAUVNIAZNTZCFE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|