C20H26N4O3 — CID 55451765
2-[4-(1-acetyl-2,3-dihydroindole-5-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55451765) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[4-(1-acetyl-2,3-dihydroindole-5-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(1-acetyl-2,3-dihydroindole-5-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55451765 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[4-(1-acetyl-2,3-dihydroindole-5-carbonyl)piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)c2ccc3c(c2)CCN3C(C)=O)CC1 |
| InChI | InChI=1S/C20H26N4O3/c1-3-7-21-19(26)14-22-9-11-23(12-10-22)20(27)17-4-5-18-16(13-17)6-8-24(18)15(2)25/h3-5,13H,1,6-12,14H2,2H3,(H,21,26) |
| InChIKey | GIWGDVRDELXNSK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|