C23H25N3O3 — CID 55451880
2-[4-(2-benzo[e][1]benzofuran-1-ylacetyl)piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55451880) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[4-(2-benzo[e][1]benzofuran-1-ylacetyl)piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(2-benzo[e][1]benzofuran-1-ylacetyl)piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55451880 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[4-(2-benzo[e][1]benzofuran-1-ylacetyl)piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)Cc2coc3ccc4ccccc4c23)CC1 |
| InChI | InChI=1S/C23H25N3O3/c1-2-9-24-21(27)15-25-10-12-26(13-11-25)22(28)14-18-16-29-20-8-7-17-5-3-4-6-19(17)23(18)20/h2-8,16H,1,9-15H2,(H,24,27) |
| InChIKey | NTISWBJIPSJJPF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|