C23H23N3O5S2 — CID 55452894
ethyl 5-methyl-2-[(5-methylsulfanyl-2-nitrobenzoyl)-(2-phenylethyl)amino]-1,3-thiazole-4-carboxylate (PubChem CID 55452894) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(5-methylsulfanyl-2-nitrobenzoyl)-(2-phenylethyl)amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-2-[(5-methylsulfanyl-2-nitrobenzoyl)-(2-phenylethyl)amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55452894 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | ethyl 5-methyl-2-[(5-methylsulfanyl-2-nitrobenzoyl)-(2-phenylethyl)amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N(CCc2ccccc2)C(=O)c2cc(SC)ccc2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C23H23N3O5S2/c1-4-31-22(28)20-15(2)33-23(24-20)25(13-12-16-8-6-5-7-9-16)21(27)18-14-17(32-3)10-11-19(18)26(29)30/h5-11,14H,4,12-13H2,1-3H3 |
| InChIKey | MONUKMVSEKPCFR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|