C22H32N4O4S — CID 55455255
N-[[4-(dimethylamino)phenyl]methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-ethylpiperidine-3-carboxamide (PubChem CID 55455255) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-ethylpiperidine-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-ethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55455255 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-N-ethylpiperidine-3-carboxamide |
| SMILES | CCN(Cc1ccc(N(C)C)cc1)C(=O)C1CCCN(S(=O)(=O)c2c(C)noc2C)C1 |
| InChI | InChI=1S/C22H32N4O4S/c1-6-25(14-18-9-11-20(12-10-18)24(4)5)22(27)19-8-7-13-26(15-19)31(28,29)21-16(2)23-30-17(21)3/h9-12,19H,6-8,13-15H2,1-5H3 |
| InChIKey | DYRFOBDNYKSAFC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|