C16H13BrN4O3S — CID 55456953
(E)-3-(5-bromothiophen-2-yl)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide (PubChem CID 55456953) has the molecular formula C16H13BrN4O3S and a molecular weight of 421.28 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55456953 |
| Molecular Formula | C16H13BrN4O3S |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)prop-2-enamide |
| SMILES | Cn1c(=O)c2cc(NC(=O)/C=C/c3ccc(Br)s3)cnc2n(C)c1=O |
| InChI | InChI=1S/C16H13BrN4O3S/c1-20-14-11(15(23)21(2)16(20)24)7-9(8-18-14)19-13(22)6-4-10-3-5-12(17)25-10/h3-8H,1-2H3,(H,19,22)/b6-4+ |
| InChIKey | AWYXIWNZGHLKLH-GQCTYLIASA-N |
| XLogP | 2.11 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|