C14H17N7O4S — CID 55458116
[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55458116) has the molecular formula C14H17N7O4S and a molecular weight of 379.40 g/mol. Its IUPAC name is [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55458116 |
| Molecular Formula | C14H17N7O4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | CN(C)c1nc(N)nc(COC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)n1 |
| InChI | InChI=1S/C14H17N7O4S/c1-20(2)14-17-10(16-13(15)18-14)8-25-12(22)9-3-4-11-19-26(23,24)6-5-21(11)7-9/h3-4,7H,5-6,8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | QDXQYNKNZPVIJC-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 143.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |