C20H22FNO4 — CID 55459669
[1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(3-methoxy-4-methylphenyl)acetate (PubChem CID 55459669) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is [1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(3-methoxy-4-methylphenyl)acetate.
| Compound Name | [1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(3-methoxy-4-methylphenyl)acetate |
|---|---|
| PubChem CID | 55459669 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(3-methoxy-4-methylphenyl)acetate |
| SMILES | COc1cc(CC(=O)OC(C)C(=O)Nc2ccc(C)c(F)c2)ccc1C |
| InChI | InChI=1S/C20H22FNO4/c1-12-6-8-16(11-17(12)21)22-20(24)14(3)26-19(23)10-15-7-5-13(2)18(9-15)25-4/h5-9,11,14H,10H2,1-4H3,(H,22,24) |
| InChIKey | NZPFBWFXCOJRCN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |