C20H10N4O5S — CID 554603
N-(1,3-dioxoisoindol-2-yl)-1,3-dioxo-2-(1,3-thiazol-2-yl)isoindole-5-carboxamide (PubChem CID 554603) has the molecular formula C20H10N4O5S and a molecular weight of 418.39 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-2-yl)-1,3-dioxo-2-(1,3-thiazol-2-yl)isoindole-5-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-2-yl)-1,3-dioxo-2-(1,3-thiazol-2-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 554603 |
| Molecular Formula | C20H10N4O5S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-(1,3-dioxoisoindol-2-yl)-1,3-dioxo-2-(1,3-thiazol-2-yl)isoindole-5-carboxamide |
| SMILES | O=C(NN1C(=O)c2ccccc2C1=O)c1ccc2c(c1)C(=O)N(c1nccs1)C2=O |
| InChI | InChI=1S/C20H10N4O5S/c25-15(22-24-18(28)11-3-1-2-4-12(11)19(24)29)10-5-6-13-14(9-10)17(27)23(16(13)26)20-21-7-8-30-20/h1-9H,(H,22,25) |
| InChIKey | IYYJTUBPNXQNKN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|