C25H33N5O3 — CID 55461369
4-[[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]methyl]benzonitrile (PubChem CID 55461369) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 4-[[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 55461369 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 4-[[4-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]methyl]benzonitrile |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)N1CCCN(Cc3ccc(C#N)cc3)CC1)C2=O |
| InChI | InChI=1S/C25H33N5O3/c1-2-19-8-10-25(11-9-19)23(32)30(24(33)27-25)18-22(31)29-13-3-12-28(14-15-29)17-21-6-4-20(16-26)5-7-21/h4-7,19H,2-3,8-15,17-18H2,1H3,(H,27,33) |
| InChIKey | NVZRWDNIBBPAQC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|