C19H19N3O6S2 — CID 55461963
methyl 5-[[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 55461963) has the molecular formula C19H19N3O6S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is methyl 5-[[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 55461963 |
| Molecular Formula | C19H19N3O6S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | methyl 5-[[(2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN(C)C(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)oc1C |
| InChI | InChI=1S/C19H19N3O6S2/c1-11-14(18(24)27-3)9-13(28-11)10-21(2)17(23)12-4-5-15-16(8-12)29-19-20-30(25,26)7-6-22(15)19/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | PHEKSYZHCDCQNT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |