About methyl 3-methoxyoctadecanoate
methyl 3-methoxyoctadecanoate (PubChem CID 554628) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is methyl 3-methoxyoctadecanoate.
Molecular Properties
| Compound Name | methyl 3-methoxyoctadecanoate |
| PubChem CID | 554628 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | methyl 3-methoxyoctadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(CC(=O)OC)OC |
| InChI | InChI=1S/C20H40O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22-2)18-20(21)23-3/h19H,4-18H2,1-3H3 |
| InChIKey | WOAHZSYEFOOHQB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-methoxyoctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methoxyoctadecanoate?
The IUPAC name of methyl 3-methoxyoctadecanoate (CID 554628) is methyl 3-methoxyoctadecanoate.
What is the SMILES notation for methyl 3-methoxyoctadecanoate?
The canonical SMILES for methyl 3-methoxyoctadecanoate is CCCCCCCCCCCCCCCC(CC(=O)OC)OC.
What is the InChIKey of methyl 3-methoxyoctadecanoate?
The InChIKey is WOAHZSYEFOOHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22-2)18-20(21)23-3/h19H,4-18H2,1-3H3.
What are the key properties of methyl 3-methoxyoctadecanoate?
methyl 3-methoxyoctadecanoate has a molecular weight of 328.54 g/mol, XLogP of 6.05, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxyoctadecanoate is sourced from PubChem (CID 554628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).