About (1-propyltetrazol-5-yl)methyl furan-3-carboxylate
(1-propyltetrazol-5-yl)methyl furan-3-carboxylate (PubChem CID 55463280) has the molecular formula C10H12N4O3
and a molecular weight of 236.23 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl furan-3-carboxylate.
Molecular Properties
| Compound Name | (1-propyltetrazol-5-yl)methyl furan-3-carboxylate |
| PubChem CID | 55463280 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl furan-3-carboxylate |
| SMILES | CCCn1nnnc1COC(=O)c1ccoc1 |
| InChI | InChI=1S/C10H12N4O3/c1-2-4-14-9(11-12-13-14)7-17-10(15)8-3-5-16-6-8/h3,5-6H,2,4,7H2,1H3 |
| InChIKey | LPHIFYVWRIRYQP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-propyltetrazol-5-yl)methyl furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propyltetrazol-5-yl)methyl furan-3-carboxylate?
The IUPAC name of (1-propyltetrazol-5-yl)methyl furan-3-carboxylate (CID 55463280) is (1-propyltetrazol-5-yl)methyl furan-3-carboxylate.
What is the SMILES notation for (1-propyltetrazol-5-yl)methyl furan-3-carboxylate?
The canonical SMILES for (1-propyltetrazol-5-yl)methyl furan-3-carboxylate is CCCn1nnnc1COC(=O)c1ccoc1.
What is the InChIKey of (1-propyltetrazol-5-yl)methyl furan-3-carboxylate?
The InChIKey is LPHIFYVWRIRYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O3/c1-2-4-14-9(11-12-13-14)7-17-10(15)8-3-5-16-6-8/h3,5-6H,2,4,7H2,1H3.
What are the key properties of (1-propyltetrazol-5-yl)methyl furan-3-carboxylate?
(1-propyltetrazol-5-yl)methyl furan-3-carboxylate has a molecular weight of 236.23 g/mol, XLogP of 1.03, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propyltetrazol-5-yl)methyl furan-3-carboxylate is sourced from PubChem (CID 55463280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).