About 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one
5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one (PubChem CID 55464297) has the molecular formula C19H20FN3O3
and a molecular weight of 357.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one |
| PubChem CID | 55464297 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one |
| SMILES | Cc1cccc(OCCN(C)Cn2nc(-c3ccc(F)cc3)oc2=O)c1 |
| InChI | InChI=1S/C19H20FN3O3/c1-14-4-3-5-17(12-14)25-11-10-22(2)13-23-19(24)26-18(21-23)15-6-8-16(20)9-7-15/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | AOUKXLVQHAYZOV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one?
The IUPAC name of 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one (CID 55464297) is 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one?
The canonical SMILES for 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one is Cc1cccc(OCCN(C)Cn2nc(-c3ccc(F)cc3)oc2=O)c1.
What is the InChIKey of 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one?
The InChIKey is AOUKXLVQHAYZOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O3/c1-14-4-3-5-17(12-14)25-11-10-22(2)13-23-19(24)26-18(21-23)15-6-8-16(20)9-7-15/h3-9,12H,10-11,13H2,1-2H3.
What are the key properties of 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one?
5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one has a molecular weight of 357.39 g/mol, XLogP of 2.92, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-3-[[methyl-[2-(3-methylphenoxy)ethyl]amino]methyl]-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 55464297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).