C22H25N3O5S — CID 55465256
2-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 55465256) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | 2-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 55465256 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | CC1Oc2ccccc2OC1C(=O)Nc1cccc(S(=O)(=O)NC2=NCCCCC2)c1 |
| InChI | InChI=1S/C22H25N3O5S/c1-15-21(30-19-11-5-4-10-18(19)29-15)22(26)24-16-8-7-9-17(14-16)31(27,28)25-20-12-3-2-6-13-23-20/h4-5,7-11,14-15,21H,2-3,6,12-13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | MKMZUKSGBRKFNQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |