C26H30N2O6 — CID 55467724
[2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 55467724) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is [2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55467724 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OCC(=O)N2CCC(C(=O)Nc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C26H30N2O6/c1-3-33-22-11-9-19(17-23(22)32-2)10-12-25(30)34-18-24(29)28-15-13-20(14-16-28)26(31)27-21-7-5-4-6-8-21/h4-12,17,20H,3,13-16,18H2,1-2H3,(H,27,31)/b12-10+ |
| InChIKey | CMNTWUOONFYKAC-ZRDIBKRKSA-N |
| XLogP | 3.53 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|