About 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile
4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile (PubChem CID 55470957) has the molecular formula C22H22ClN3O2S
and a molecular weight of 427.96 g/mol. Its IUPAC name is 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile |
| PubChem CID | 55470957 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)CN2CCC(c3nc4cc(Cl)ccc4s3)CC2)cc1 |
| InChI | InChI=1S/C22H22ClN3O2S/c23-17-3-6-21-20(11-17)25-22(29-21)16-7-9-26(10-8-16)13-18(27)14-28-19-4-1-15(12-24)2-5-19/h1-6,11,16,18,27H,7-10,13-14H2 |
| InChIKey | NSINIFMUMPZRPC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile?
The IUPAC name of 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile (CID 55470957) is 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile.
What is the SMILES notation for 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile?
The canonical SMILES for 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile is N#Cc1ccc(OCC(O)CN2CCC(c3nc4cc(Cl)ccc4s3)CC2)cc1.
What is the InChIKey of 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile?
The InChIKey is NSINIFMUMPZRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN3O2S/c23-17-3-6-21-20(11-17)25-22(29-21)16-7-9-26(10-8-16)13-18(27)14-28-19-4-1-15(12-24)2-5-19/h1-6,11,16,18,27H,7-10,13-14H2.
What are the key properties of 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile?
4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile has a molecular weight of 427.96 g/mol, XLogP of 4.44, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-hydroxypropoxy]benzonitrile is sourced from PubChem (CID 55470957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).