C22H21BrN2O4 — CID 55471512
[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate (PubChem CID 55471512) has the molecular formula C22H21BrN2O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is [2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate.
| Compound Name | [2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 55471512 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | [2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OCC(=O)NC(C)c3ccc(Br)cc3)c(C)nc2c1 |
| InChI | InChI=1S/C22H21BrN2O4/c1-13(15-4-7-17(23)8-5-15)25-21(26)12-29-22(27)19-10-16-6-9-18(28-3)11-20(16)24-14(19)2/h4-11,13H,12H2,1-3H3,(H,25,26) |
| InChIKey | YSNRJKAPQVMHPZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |