About butan-2-yloxy-dimethyl-trimethylsilylsilane
butan-2-yloxy-dimethyl-trimethylsilylsilane (PubChem CID 554727) has the molecular formula C9H24OSi2
and a molecular weight of 204.46 g/mol. Its IUPAC name is butan-2-yloxy-dimethyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | butan-2-yloxy-dimethyl-trimethylsilylsilane |
| PubChem CID | 554727 |
| Molecular Formula | C9H24OSi2 |
| Molecular Weight | 204.46 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | butan-2-yloxy-dimethyl-trimethylsilylsilane |
| SMILES | CCC(C)O[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C9H24OSi2/c1-8-9(2)10-12(6,7)11(3,4)5/h9H,8H2,1-7H3 |
| InChIKey | RPAHPPWLPWOGIG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yloxy-dimethyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yloxy-dimethyl-trimethylsilylsilane?
The IUPAC name of butan-2-yloxy-dimethyl-trimethylsilylsilane (CID 554727) is butan-2-yloxy-dimethyl-trimethylsilylsilane.
What is the SMILES notation for butan-2-yloxy-dimethyl-trimethylsilylsilane?
The canonical SMILES for butan-2-yloxy-dimethyl-trimethylsilylsilane is CCC(C)O[Si](C)(C)[Si](C)(C)C.
What is the InChIKey of butan-2-yloxy-dimethyl-trimethylsilylsilane?
The InChIKey is RPAHPPWLPWOGIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H24OSi2/c1-8-9(2)10-12(6,7)11(3,4)5/h9H,8H2,1-7H3.
What are the key properties of butan-2-yloxy-dimethyl-trimethylsilylsilane?
butan-2-yloxy-dimethyl-trimethylsilylsilane has a molecular weight of 204.46 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yloxy-dimethyl-trimethylsilylsilane is sourced from PubChem (CID 554727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).