C21H27N3O3S — CID 55472850
1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 55472850) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 55472850 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H27N3O3S/c1-3-24(4-2)28(26,27)18-12-9-16(10-13-18)15-22-21(25)23-20-14-11-17-7-5-6-8-19(17)20/h5-10,12-13,20H,3-4,11,14-15H2,1-2H3,(H2,22,23,25) |
| InChIKey | NWACRZNUIRZCBQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |