C18H26N2O4S — CID 55472900
5-methyl-3-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]oxolan-2-one (PubChem CID 55472900) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 5-methyl-3-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]oxolan-2-one.
| Compound Name | 5-methyl-3-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]oxolan-2-one |
|---|---|
| PubChem CID | 55472900 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 5-methyl-3-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]oxolan-2-one |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(C3CC(C)OC3=O)CC2)cc1 |
| InChI | InChI=1S/C18H26N2O4S/c1-3-4-15-5-7-16(8-6-15)25(22,23)20-11-9-19(10-12-20)17-13-14(2)24-18(17)21/h5-8,14,17H,3-4,9-13H2,1-2H3 |
| InChIKey | JWADWMOJJCOTBW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |