C23H27N3O6S — CID 55473353
4-[4-[3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 55473353) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is 4-[4-[3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[4-[3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 55473353 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-[4-[3-(4-acetyl-2-methoxyphenoxy)-2-hydroxypropyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | COc1cc(C(C)=O)ccc1OCC(O)CN1CCN(S(=O)(=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O6S/c1-17(27)19-5-8-22(23(13-19)31-2)32-16-20(28)15-25-9-11-26(12-10-25)33(29,30)21-6-3-18(14-24)4-7-21/h3-8,13,20,28H,9-12,15-16H2,1-2H3 |
| InChIKey | SQBXLPCKBJETCM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |