C22H22N6O3S — CID 55474991
N-[2-(4-nitroanilino)ethyl]-1-propan-2-yl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55474991) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-[2-(4-nitroanilino)ethyl]-1-propan-2-yl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[2-(4-nitroanilino)ethyl]-1-propan-2-yl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55474991 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[2-(4-nitroanilino)ethyl]-1-propan-2-yl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC(C)n1ncc2c(C(=O)NCCNc3ccc([N+](=O)[O-])cc3)cc(-c3cccs3)nc21 |
| InChI | InChI=1S/C22H22N6O3S/c1-14(2)27-21-18(13-25-27)17(12-19(26-21)20-4-3-11-32-20)22(29)24-10-9-23-15-5-7-16(8-6-15)28(30)31/h3-8,11-14,23H,9-10H2,1-2H3,(H,24,29) |
| InChIKey | RPOQBEAPQOYHPB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|