C24H22N4O — CID 55475406
N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-6-phenylpyridine-3-carboxamide (PubChem CID 55475406) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-6-phenylpyridine-3-carboxamide.
| Compound Name | N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-6-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55475406 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-6-phenylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)NCc1ccccc1Cn1ccnc1 |
| InChI | InChI=1S/C24H22N4O/c1-18-22(11-12-23(27-18)19-7-3-2-4-8-19)24(29)26-15-20-9-5-6-10-21(20)16-28-14-13-25-17-28/h2-14,17H,15-16H2,1H3,(H,26,29) |
| InChIKey | RLUYSWWKQSKADV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |