About 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one
2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 55475685) has the molecular formula C18H16Cl2N4O3S
and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 55475685 |
| Molecular Formula | C18H16Cl2N4O3S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C18H16Cl2N4O3S/c19-14-5-4-13(11-15(14)20)28(26,27)23-9-7-22(8-10-23)17-12-18(25)24-6-2-1-3-16(24)21-17/h1-6,11-12H,7-10H2 |
| InChIKey | DSBAQGDOKMRPOR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one (CID 55475685) is 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one is O=c1cc(N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)nc2ccccn12.
What is the InChIKey of 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is DSBAQGDOKMRPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N4O3S/c19-14-5-4-13(11-15(14)20)28(26,27)23-9-7-22(8-10-23)17-12-18(25)24-6-2-1-3-16(24)21-17/h1-6,11-12H,7-10H2.
What are the key properties of 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one?
2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 439.32 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 55475685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).