C21H15F3N6OS — CID 55476747
N-[(E)-benzylideneamino]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 55476747) has the molecular formula C21H15F3N6OS and a molecular weight of 456.45 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55476747 |
| Molecular Formula | C21H15F3N6OS |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2ncccn2n1)N(/N=C/c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F3N6OS/c22-21(23,24)16-8-4-9-17(12-16)30(26-13-15-6-2-1-3-7-15)18(31)14-32-20-27-19-25-10-5-11-29(19)28-20/h1-13H,14H2/b26-13+ |
| InChIKey | FBKQGYZQCWRJBY-LGJNPRDNSA-N |
| XLogP | 4.30 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|