C16H19BrN2O3 — CID 55476879
2-(4-bromophenoxy)ethyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate (PubChem CID 55476879) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate.
| Compound Name | 2-(4-bromophenoxy)ethyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 55476879 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| SMILES | Cc1nn(C)c(C)c1CC(=O)OCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H19BrN2O3/c1-11-15(12(2)19(3)18-11)10-16(20)22-9-8-21-14-6-4-13(17)5-7-14/h4-7H,8-10H2,1-3H3 |
| InChIKey | XDNOLDFCUQCYOB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|