C21H26N4O3S2 — CID 55479640
1,3-dimethyl-6-[(12-oxo-11-pentyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanylmethyl]pyrimidine-2,4-dione (PubChem CID 55479640) has the molecular formula C21H26N4O3S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1,3-dimethyl-6-[(12-oxo-11-pentyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanylmethyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[(12-oxo-11-pentyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanylmethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55479640 |
| Molecular Formula | C21H26N4O3S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1,3-dimethyl-6-[(12-oxo-11-pentyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanylmethyl]pyrimidine-2,4-dione |
| SMILES | CCCCCn1c(SCc2cc(=O)n(C)c(=O)n2C)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C21H26N4O3S2/c1-4-5-6-10-25-19(27)17-14-8-7-9-15(14)30-18(17)22-20(25)29-12-13-11-16(26)24(3)21(28)23(13)2/h11H,4-10,12H2,1-3H3 |
| InChIKey | HJVMLJFUUMATLP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|