C19H22Cl2N2O — CID 55482442
3-[benzyl(propyl)amino]-N-(2,6-dichlorophenyl)propanamide (PubChem CID 55482442) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is 3-[benzyl(propyl)amino]-N-(2,6-dichlorophenyl)propanamide.
| Compound Name | 3-[benzyl(propyl)amino]-N-(2,6-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 55482442 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[benzyl(propyl)amino]-N-(2,6-dichlorophenyl)propanamide |
| SMILES | CCCN(CCC(=O)Nc1c(Cl)cccc1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C19H22Cl2N2O/c1-2-12-23(14-15-7-4-3-5-8-15)13-11-18(24)22-19-16(20)9-6-10-17(19)21/h3-10H,2,11-14H2,1H3,(H,22,24) |
| InChIKey | YNEZNNFNWSGPQI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |