C23H28F2N4O3 — CID 55482803
N-(3,4-difluorophenyl)-3-[ethyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide (PubChem CID 55482803) has the molecular formula C23H28F2N4O3 and a molecular weight of 446.50 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-[ethyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide.
| Compound Name | N-(3,4-difluorophenyl)-3-[ethyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 55482803 |
| Molecular Formula | C23H28F2N4O3 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-[ethyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]propanamide |
| SMILES | CCN(CCC(=O)Nc1ccc(F)c(F)c1)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H28F2N4O3/c1-2-28(10-9-22(30)27-18-5-8-20(24)21(25)15-18)16-23(31)26-17-3-6-19(7-4-17)29-11-13-32-14-12-29/h3-8,15H,2,9-14,16H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | NKIPTFHHDWWDER-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|