C16H23BrN4O3 — CID 55485275
N-(4-bromo-2-methylphenyl)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]acetamide (PubChem CID 55485275) has the molecular formula C16H23BrN4O3 and a molecular weight of 399.29 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 55485275 |
| Molecular Formula | C16H23BrN4O3 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[[2-(tert-butylamino)-2-oxoethyl]carbamoylamino]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H23BrN4O3/c1-10-7-11(17)5-6-12(10)20-13(22)8-18-15(24)19-9-14(23)21-16(2,3)4/h5-7H,8-9H2,1-4H3,(H,20,22)(H,21,23)(H2,18,19,24) |
| InChIKey | FAEIPQQPTAUJFD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |