About 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate
2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 55485620) has the molecular formula C18H18F2N2O4
and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate.
Molecular Properties
| Compound Name | 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
| PubChem CID | 55485620 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2F)o1)OCCN1CCCC1=O |
| InChI | InChI=1S/C18H18F2N2O4/c19-12-3-4-13(14(20)10-12)15-11-21-16(26-15)5-6-18(24)25-9-8-22-7-1-2-17(22)23/h3-4,10-11H,1-2,5-9H2 |
| InChIKey | QFDHYRKHKFJLOE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate?
The IUPAC name of 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate (CID 55485620) is 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate.
What is the SMILES notation for 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate?
The canonical SMILES for 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate is O=C(CCc1ncc(-c2ccc(F)cc2F)o1)OCCN1CCCC1=O.
What is the InChIKey of 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate?
The InChIKey is QFDHYRKHKFJLOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N2O4/c19-12-3-4-13(14(20)10-12)15-11-21-16(26-15)5-6-18(24)25-9-8-22-7-1-2-17(22)23/h3-4,10-11H,1-2,5-9H2.
What are the key properties of 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate?
2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate has a molecular weight of 364.35 g/mol, XLogP of 2.72, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxopyrrolidin-1-yl)ethyl 3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoate is sourced from PubChem (CID 55485620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).