C19H14ClF2N3O3 — CID 55485978
4-chloro-N'-[3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoyl]benzohydrazide (PubChem CID 55485978) has the molecular formula C19H14ClF2N3O3 and a molecular weight of 405.79 g/mol. Its IUPAC name is 4-chloro-N'-[3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 55485978 |
| Molecular Formula | C19H14ClF2N3O3 |
| Molecular Weight | 405.79 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 4-chloro-N'-[3-[5-(2,4-difluorophenyl)-1,3-oxazol-2-yl]propanoyl]benzohydrazide |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2F)o1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClF2N3O3/c20-12-3-1-11(2-4-12)19(27)25-24-17(26)7-8-18-23-10-16(28-18)14-6-5-13(21)9-15(14)22/h1-6,9-10H,7-8H2,(H,24,26)(H,25,27) |
| InChIKey | KUQYIWLWZSJGNR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|