C23H20N4O3S — CID 55487303
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 55487303) has the molecular formula C23H20N4O3S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55487303 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccccc2)C1=O)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c28-21(19-9-7-18(8-10-19)16-26-13-4-11-25-26)24-12-14-27-22(29)20(31-23(27)30)15-17-5-2-1-3-6-17/h1-11,13,15H,12,14,16H2,(H,24,28)/b20-15- |
| InChIKey | YKRKNBMKRMJILS-HKWRFOASSA-N |
| XLogP | 3.40 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|