C25H27NO6S — CID 55488311
N-[3-(furan-2-carbonyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 55488311) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[3-(furan-2-carbonyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[3-(furan-2-carbonyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55488311 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[3-(furan-2-carbonyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2sc3c(c2C(=O)c2ccco2)CCC(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO6S/c1-14-7-8-16-20(10-14)33-25(22(16)23(28)17-6-5-9-32-17)26-21(27)13-15-11-18(29-2)24(31-4)19(12-15)30-3/h5-6,9,11-12,14H,7-8,10,13H2,1-4H3,(H,26,27) |
| InChIKey | YXBRMRFZRCDNDZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |