C22H27Cl2N3O2 — CID 55489470
2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide (PubChem CID 55489470) has the molecular formula C22H27Cl2N3O2 and a molecular weight of 436.38 g/mol. Its IUPAC name is 2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55489470 |
| Molecular Formula | C22H27Cl2N3O2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide |
| SMILES | O=C(CN1CCN(CCOc2ccccc2Cl)CC1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27Cl2N3O2/c23-19-7-5-18(6-8-19)9-10-25-22(28)17-27-13-11-26(12-14-27)15-16-29-21-4-2-1-3-20(21)24/h1-8H,9-17H2,(H,25,28) |
| InChIKey | PBPLMUGYJCRVTL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |