C23H25N3O4 — CID 55490185
N-cyclopropyl-4-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoylamino]benzamide (PubChem CID 55490185) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-cyclopropyl-4-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoylamino]benzamide.
| Compound Name | N-cyclopropyl-4-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 55490185 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-cyclopropyl-4-[2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoylamino]benzamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(C)C(=O)Nc2ccc(C(=O)NC3CC3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-15(24-21(27)14-5-16-3-12-20(30-2)13-4-16)22(28)25-18-8-6-17(7-9-18)23(29)26-19-10-11-19/h3-9,12-15,19H,10-11H2,1-2H3,(H,24,27)(H,25,28)(H,26,29)/b14-5+ |
| InChIKey | GFWLFLAPLQLFKM-LHHJGKSTSA-N |
| XLogP | 2.74 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|