C25H32N4O3S — CID 55490775
1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylethanone (PubChem CID 55490775) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is 1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylethanone.
| Compound Name | 1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylethanone |
|---|---|
| PubChem CID | 55490775 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-[2-(morpholin-4-ylmethyl)quinazolin-4-yl]sulfanylethanone |
| SMILES | COCCCn1c(C)cc(C(=O)CSc2nc(CN3CCOCC3)nc3ccccc23)c1C |
| InChI | InChI=1S/C25H32N4O3S/c1-18-15-21(19(2)29(18)9-6-12-31-3)23(30)17-33-25-20-7-4-5-8-22(20)26-24(27-25)16-28-10-13-32-14-11-28/h4-5,7-8,15H,6,9-14,16-17H2,1-3H3 |
| InChIKey | RONKGIGYNSLDOW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|