C23H34ClN3O4 — CID 55490967
tert-butyl 4-[4-[2-(2-chlorophenoxy)ethyl]piperazine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 55490967) has the molecular formula C23H34ClN3O4 and a molecular weight of 452.00 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(2-chlorophenoxy)ethyl]piperazine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(2-chlorophenoxy)ethyl]piperazine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55490967 |
| Molecular Formula | C23H34ClN3O4 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | tert-butyl 4-[4-[2-(2-chlorophenoxy)ethyl]piperazine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)N2CCN(CCOc3ccccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C23H34ClN3O4/c1-23(2,3)31-22(29)27-10-8-18(9-11-27)21(28)26-14-12-25(13-15-26)16-17-30-20-7-5-4-6-19(20)24/h4-7,18H,8-17H2,1-3H3 |
| InChIKey | KUJZRNOABUSCDF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |